C12H6Br4O2 — CID 139597677
2,4-dibromo-3-(2,4-dibromophenoxy)phenol (PubChem CID 139597677) has the molecular formula C12H6Br4O2 and a molecular weight of 501.79 g/mol. Its IUPAC name is 2,4-dibromo-3-(2,4-dibromophenoxy)phenol.
| Compound Name | 2,4-dibromo-3-(2,4-dibromophenoxy)phenol |
|---|---|
| PubChem CID | 139597677 |
| Molecular Formula | C12H6Br4O2 |
| Molecular Weight | 501.79 g/mol |
| Exact Mass | 497.71 |
| IUPAC Name | 2,4-dibromo-3-(2,4-dibromophenoxy)phenol |
| SMILES | Oc1ccc(Br)c(Oc2ccc(Br)cc2Br)c1Br |
| InChI | InChI=1S/C12H6Br4O2/c13-6-1-4-10(8(15)5-6)18-12-7(14)2-3-9(17)11(12)16/h1-5,17H |
| InChIKey | WMWMDGKRWPECMY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.79 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |