C12H5Br5O3 — CID 20847463
3,4,5-tribromo-2-(2,3-dibromo-4-hydroxyphenoxy)phenol (PubChem CID 20847463) has the molecular formula C12H5Br5O3 and a molecular weight of 596.69 g/mol. Its IUPAC name is 3,4,5-tribromo-2-(2,3-dibromo-4-hydroxyphenoxy)phenol.
| Compound Name | 3,4,5-tribromo-2-(2,3-dibromo-4-hydroxyphenoxy)phenol |
|---|---|
| PubChem CID | 20847463 |
| Molecular Formula | C12H5Br5O3 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 591.62 |
| IUPAC Name | 3,4,5-tribromo-2-(2,3-dibromo-4-hydroxyphenoxy)phenol |
| SMILES | Oc1ccc(Oc2c(O)cc(Br)c(Br)c2Br)c(Br)c1Br |
| InChI | InChI=1S/C12H5Br5O3/c13-4-3-6(19)12(11(17)8(4)14)20-7-2-1-5(18)9(15)10(7)16/h1-3,18-19H |
| InChIKey | WIQAOJHXJZOEBT-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|