C12H5Br5O2 — CID 102420969
2,5-dibromo-4-(2,4,6-tribromophenoxy)phenol (PubChem CID 102420969) has the molecular formula C12H5Br5O2 and a molecular weight of 580.69 g/mol. Its IUPAC name is 2,5-dibromo-4-(2,4,6-tribromophenoxy)phenol.
| Compound Name | 2,5-dibromo-4-(2,4,6-tribromophenoxy)phenol |
|---|---|
| PubChem CID | 102420969 |
| Molecular Formula | C12H5Br5O2 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 575.62 |
| IUPAC Name | 2,5-dibromo-4-(2,4,6-tribromophenoxy)phenol |
| SMILES | Oc1cc(Br)c(Oc2c(Br)cc(Br)cc2Br)cc1Br |
| InChI | InChI=1S/C12H5Br5O2/c13-5-1-8(16)12(9(17)2-5)19-11-4-6(14)10(18)3-7(11)15/h1-4,18H |
| InChIKey | NYUYBKKCGWUGHU-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |