C13H6Br5ClO3 — CID 133052539
2,3,5-tribromo-4-chloro-6-(3,5-dibromo-2-methoxyphenoxy)phenol (PubChem CID 133052539) has the molecular formula C13H6Br5ClO3 and a molecular weight of 645.16 g/mol. Its IUPAC name is 2,3,5-tribromo-4-chloro-6-(3,5-dibromo-2-methoxyphenoxy)phenol.
| Compound Name | 2,3,5-tribromo-4-chloro-6-(3,5-dibromo-2-methoxyphenoxy)phenol |
|---|---|
| PubChem CID | 133052539 |
| Molecular Formula | C13H6Br5ClO3 |
| Molecular Weight | 645.16 g/mol |
| Exact Mass | 639.59 |
| IUPAC Name | 2,3,5-tribromo-4-chloro-6-(3,5-dibromo-2-methoxyphenoxy)phenol |
| SMILES | COc1c(Br)cc(Br)cc1Oc1c(O)c(Br)c(Br)c(Cl)c1Br |
| InChI | InChI=1S/C13H6Br5ClO3/c1-21-12-5(15)2-4(14)3-6(12)22-13-9(18)10(19)7(16)8(17)11(13)20/h2-3,20H,1H3 |
| InChIKey | VXHZXOQAKXSCOH-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.16 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|