C8H6Br2F2O2 — CID 119008038
1,5-dibromo-3-(difluoromethoxy)-2-methoxybenzene (PubChem CID 119008038) has the molecular formula C8H6Br2F2O2 and a molecular weight of 331.94 g/mol. Its IUPAC name is 1,5-dibromo-3-(difluoromethoxy)-2-methoxybenzene.
| Compound Name | 1,5-dibromo-3-(difluoromethoxy)-2-methoxybenzene |
|---|---|
| PubChem CID | 119008038 |
| Molecular Formula | C8H6Br2F2O2 |
| Molecular Weight | 331.94 g/mol |
| Exact Mass | 329.87 |
| IUPAC Name | 1,5-dibromo-3-(difluoromethoxy)-2-methoxybenzene |
| SMILES | COc1c(Br)cc(Br)cc1OC(F)F |
| InChI | InChI=1S/C8H6Br2F2O2/c1-13-7-5(10)2-4(9)3-6(7)14-8(11)12/h2-3,8H,1H3 |
| InChIKey | IIGNASLJWMIUPF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.94 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |