C7H3Br2F2N3O — CID 152615033
2-azido-1,5-dibromo-3-(difluoromethoxy)benzene (PubChem CID 152615033) has the molecular formula C7H3Br2F2N3O and a molecular weight of 342.93 g/mol. Its IUPAC name is 2-azido-1,5-dibromo-3-(difluoromethoxy)benzene.
| Compound Name | 2-azido-1,5-dibromo-3-(difluoromethoxy)benzene |
|---|---|
| PubChem CID | 152615033 |
| Molecular Formula | C7H3Br2F2N3O |
| Molecular Weight | 342.93 g/mol |
| Exact Mass | 340.86 |
| IUPAC Name | 2-azido-1,5-dibromo-3-(difluoromethoxy)benzene |
| SMILES | [N-]=[N+]=Nc1c(Br)cc(Br)cc1OC(F)F |
| InChI | InChI=1S/C7H3Br2F2N3O/c8-3-1-4(9)6(13-14-12)5(2-3)15-7(10)11/h1-2,7H |
| InChIKey | ZAICEGKOFDUKDP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.93 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|