C7H3Br3F2O — CID 118826351
1,2,5-tribromo-3-(difluoromethoxy)benzene (PubChem CID 118826351) has the molecular formula C7H3Br3F2O and a molecular weight of 380.81 g/mol. Its IUPAC name is 1,2,5-tribromo-3-(difluoromethoxy)benzene.
| Compound Name | 1,2,5-tribromo-3-(difluoromethoxy)benzene |
|---|---|
| PubChem CID | 118826351 |
| Molecular Formula | C7H3Br3F2O |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 377.77 |
| IUPAC Name | 1,2,5-tribromo-3-(difluoromethoxy)benzene |
| SMILES | FC(F)Oc1cc(Br)cc(Br)c1Br |
| InChI | InChI=1S/C7H3Br3F2O/c8-3-1-4(9)6(10)5(2-3)13-7(11)12/h1-2,7H |
| InChIKey | NEXYNWAWRCRRDG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|