(E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid

C10H6Br2F2O3 — CID 119009070

IUPAC(E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid
SMILESO=C(O)/C=C/c1c(Br)cc(Br)cc1OC(F)F
InChIInChI=1S/C10H6Br2F2O3/c11-5-3-7(12)6(1-2-9(15)16)8(4-5)17-10(13)14/h1-4,10H,(H,15,16)/b2-1+
InChIKeyVBYOVCHUARUWEK-OWOJBTEDSA-N
MW371.96 g/mol
LogP3.91
Rot. Bonds4

About (E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid

(E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid (PubChem CID 119009070) has the molecular formula C10H6Br2F2O3 and a molecular weight of 371.96 g/mol. Its IUPAC name is (E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid
PubChem CID119009070
Molecular FormulaC10H6Br2F2O3
Molecular Weight371.96 g/mol
Exact Mass369.87
IUPAC Name(E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid
SMILESO=C(O)/C=C/c1c(Br)cc(Br)cc1OC(F)F
InChIInChI=1S/C10H6Br2F2O3/c11-5-3-7(12)6(1-2-9(15)16)8(4-5)17-10(13)14/h1-4,10H,(H,15,16)/b2-1+
InChIKeyVBYOVCHUARUWEK-OWOJBTEDSA-N
XLogP3.91
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500371.96
LogP ≤ 53.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid?
The IUPAC name of (E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid (CID 119009070) is (E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid.
What is the SMILES notation for (E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid?
The canonical SMILES for (E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid is O=C(O)/C=C/c1c(Br)cc(Br)cc1OC(F)F.
What is the InChIKey of (E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid?
The InChIKey is VBYOVCHUARUWEK-OWOJBTEDSA-N. The full InChI is InChI=1S/C10H6Br2F2O3/c11-5-3-7(12)6(1-2-9(15)16)8(4-5)17-10(13)14/h1-4,10H,(H,15,16)/b2-1+.
What are the key properties of (E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid?
(E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid has a molecular weight of 371.96 g/mol, XLogP of 3.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[2,4-dibromo-6-(difluoromethoxy)phenyl]prop-2-enoic acid is sourced from PubChem (CID 119009070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).