C12H12F2O3 — CID 171026138
(E)-3-[3-(difluoromethoxy)-2,6-dimethylphenyl]prop-2-enoic acid (PubChem CID 171026138) has the molecular formula C12H12F2O3 and a molecular weight of 242.22 g/mol. Its IUPAC name is (E)-3-[3-(difluoromethoxy)-2,6-dimethylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(difluoromethoxy)-2,6-dimethylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 171026138 |
| Molecular Formula | C12H12F2O3 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (E)-3-[3-(difluoromethoxy)-2,6-dimethylphenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(OC(F)F)c(C)c1/C=C/C(=O)O |
| InChI | InChI=1S/C12H12F2O3/c1-7-3-5-10(17-12(13)14)8(2)9(7)4-6-11(15)16/h3-6,12H,1-2H3,(H,15,16)/b6-4+ |
| InChIKey | DLSDILZOWYRKCI-GQCTYLIASA-N |
| XLogP | 3.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|