C9H9BrF2N4O — CID 76872439
2-[[5-bromo-2-(difluoromethoxy)phenyl]methylideneamino]guanidine (PubChem CID 76872439) has the molecular formula C9H9BrF2N4O and a molecular weight of 307.10 g/mol. Its IUPAC name is 2-[[5-bromo-2-(difluoromethoxy)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[5-bromo-2-(difluoromethoxy)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 76872439 |
| Molecular Formula | C9H9BrF2N4O |
| Molecular Weight | 307.10 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 2-[[5-bromo-2-(difluoromethoxy)phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1cc(Br)ccc1OC(F)F |
| InChI | InChI=1S/C9H9BrF2N4O/c10-6-1-2-7(17-8(11)12)5(3-6)4-15-16-9(13)14/h1-4,8H,(H4,13,14,16) |
| InChIKey | WYFXTHMXMXTSJX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.10 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|