C11H12BrF2NO — CID 76997310
4-[5-bromo-2-(difluoromethoxy)phenyl]but-3-en-1-amine (PubChem CID 76997310) has the molecular formula C11H12BrF2NO and a molecular weight of 292.12 g/mol. Its IUPAC name is 4-[5-bromo-2-(difluoromethoxy)phenyl]but-3-en-1-amine.
| Compound Name | 4-[5-bromo-2-(difluoromethoxy)phenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 76997310 |
| Molecular Formula | C11H12BrF2NO |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 4-[5-bromo-2-(difluoromethoxy)phenyl]but-3-en-1-amine |
| SMILES | NCCC=Cc1cc(Br)ccc1OC(F)F |
| InChI | InChI=1S/C11H12BrF2NO/c12-9-4-5-10(16-11(13)14)8(7-9)3-1-2-6-15/h1,3-5,7,11H,2,6,15H2 |
| InChIKey | VUOFKXRYUKKKJD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |