C9H10BrF2NO2 — CID 43622273
[3-bromo-4-(difluoromethoxy)-5-methoxyphenyl]methanamine (PubChem CID 43622273) has the molecular formula C9H10BrF2NO2 and a molecular weight of 282.08 g/mol. Its IUPAC name is [3-bromo-4-(difluoromethoxy)-5-methoxyphenyl]methanamine.
| Compound Name | [3-bromo-4-(difluoromethoxy)-5-methoxyphenyl]methanamine |
|---|---|
| PubChem CID | 43622273 |
| Molecular Formula | C9H10BrF2NO2 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | [3-bromo-4-(difluoromethoxy)-5-methoxyphenyl]methanamine |
| SMILES | COc1cc(CN)cc(Br)c1OC(F)F |
| InChI | InChI=1S/C9H10BrF2NO2/c1-14-7-3-5(4-13)2-6(10)8(7)15-9(11)12/h2-3,9H,4,13H2,1H3 |
| InChIKey | BFVPQKZWNNVPNN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |