C11H14BrF2NO2 — CID 43622358
N-[[3-bromo-4-(difluoromethoxy)-5-methoxyphenyl]methyl]ethanamine (PubChem CID 43622358) has the molecular formula C11H14BrF2NO2 and a molecular weight of 310.14 g/mol. Its IUPAC name is N-[[3-bromo-4-(difluoromethoxy)-5-methoxyphenyl]methyl]ethanamine.
| Compound Name | N-[[3-bromo-4-(difluoromethoxy)-5-methoxyphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 43622358 |
| Molecular Formula | C11H14BrF2NO2 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | N-[[3-bromo-4-(difluoromethoxy)-5-methoxyphenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(Br)c(OC(F)F)c(OC)c1 |
| InChI | InChI=1S/C11H14BrF2NO2/c1-3-15-6-7-4-8(12)10(17-11(13)14)9(5-7)16-2/h4-5,11,15H,3,6H2,1-2H3 |
| InChIKey | CNYGNPXWEAJGEE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |