About 2,4-dibromo-6-(2,6-dibromophenoxy)phenol
2,4-dibromo-6-(2,6-dibromophenoxy)phenol (PubChem CID 125360388) has the molecular formula C12H6Br4O2
and a molecular weight of 501.79 g/mol. Its IUPAC name is 2,4-dibromo-6-(2,6-dibromophenoxy)phenol.
Molecular Properties
| Compound Name | 2,4-dibromo-6-(2,6-dibromophenoxy)phenol |
| PubChem CID | 125360388 |
| Molecular Formula | C12H6Br4O2 |
| Molecular Weight | 501.79 g/mol |
| Exact Mass | 497.71 |
| IUPAC Name | 2,4-dibromo-6-(2,6-dibromophenoxy)phenol |
| SMILES | Oc1c(Br)cc(Br)cc1Oc1c(Br)cccc1Br |
| InChI | InChI=1S/C12H6Br4O2/c13-6-4-9(16)11(17)10(5-6)18-12-7(14)2-1-3-8(12)15/h1-5,17H |
| InChIKey | PTBABWOWPYFWEG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.79 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dibromo-6-(2,6-dibromophenoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-6-(2,6-dibromophenoxy)phenol?
The IUPAC name of 2,4-dibromo-6-(2,6-dibromophenoxy)phenol (CID 125360388) is 2,4-dibromo-6-(2,6-dibromophenoxy)phenol.
What is the SMILES notation for 2,4-dibromo-6-(2,6-dibromophenoxy)phenol?
The canonical SMILES for 2,4-dibromo-6-(2,6-dibromophenoxy)phenol is Oc1c(Br)cc(Br)cc1Oc1c(Br)cccc1Br.
What is the InChIKey of 2,4-dibromo-6-(2,6-dibromophenoxy)phenol?
The InChIKey is PTBABWOWPYFWEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Br4O2/c13-6-4-9(16)11(17)10(5-6)18-12-7(14)2-1-3-8(12)15/h1-5,17H.
What are the key properties of 2,4-dibromo-6-(2,6-dibromophenoxy)phenol?
2,4-dibromo-6-(2,6-dibromophenoxy)phenol has a molecular weight of 501.79 g/mol, XLogP of 6.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-6-(2,6-dibromophenoxy)phenol is sourced from PubChem (CID 125360388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).