C22H14Br4O6 — CID 176845683
bis[(3,5-dibromo-2-hydroxyphenyl)methyl] benzene-1,3-dicarboxylate (PubChem CID 176845683) has the molecular formula C22H14Br4O6 and a molecular weight of 693.96 g/mol. Its IUPAC name is bis[(3,5-dibromo-2-hydroxyphenyl)methyl] benzene-1,3-dicarboxylate.
| Compound Name | bis[(3,5-dibromo-2-hydroxyphenyl)methyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 176845683 |
| Molecular Formula | C22H14Br4O6 |
| Molecular Weight | 693.96 g/mol |
| Exact Mass | 689.75 |
| IUPAC Name | bis[(3,5-dibromo-2-hydroxyphenyl)methyl] benzene-1,3-dicarboxylate |
| SMILES | O=C(OCc1cc(Br)cc(Br)c1O)c1cccc(C(=O)OCc2cc(Br)cc(Br)c2O)c1 |
| InChI | InChI=1S/C22H14Br4O6/c23-15-5-13(19(27)17(25)7-15)9-31-21(29)11-2-1-3-12(4-11)22(30)32-10-14-6-16(24)8-18(26)20(14)28/h1-8,27-28H,9-10H2 |
| InChIKey | IHOMQFHYZHHJRU-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.96 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |