C17H17BrN2O5 — CID 8803838
(4-bromo-2,5-dimethoxyphenyl)methyl 3-(carbamoylamino)benzoate (PubChem CID 8803838) has the molecular formula C17H17BrN2O5 and a molecular weight of 409.24 g/mol. Its IUPAC name is (4-bromo-2,5-dimethoxyphenyl)methyl 3-(carbamoylamino)benzoate.
| Compound Name | (4-bromo-2,5-dimethoxyphenyl)methyl 3-(carbamoylamino)benzoate |
|---|---|
| PubChem CID | 8803838 |
| Molecular Formula | C17H17BrN2O5 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | (4-bromo-2,5-dimethoxyphenyl)methyl 3-(carbamoylamino)benzoate |
| SMILES | COc1cc(COC(=O)c2cccc(NC(N)=O)c2)c(OC)cc1Br |
| InChI | InChI=1S/C17H17BrN2O5/c1-23-14-8-13(18)15(24-2)7-11(14)9-25-16(21)10-4-3-5-12(6-10)20-17(19)22/h3-8H,9H2,1-2H3,(H3,19,20,22) |
| InChIKey | VOTJOZGVJNKCSO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |