C14H13BrO4S — CID 8631233
(4-bromo-2,5-dimethoxyphenyl)methyl thiophene-2-carboxylate (PubChem CID 8631233) has the molecular formula C14H13BrO4S and a molecular weight of 357.23 g/mol. Its IUPAC name is (4-bromo-2,5-dimethoxyphenyl)methyl thiophene-2-carboxylate.
| Compound Name | (4-bromo-2,5-dimethoxyphenyl)methyl thiophene-2-carboxylate |
|---|---|
| PubChem CID | 8631233 |
| Molecular Formula | C14H13BrO4S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | (4-bromo-2,5-dimethoxyphenyl)methyl thiophene-2-carboxylate |
| SMILES | COc1cc(COC(=O)c2cccs2)c(OC)cc1Br |
| InChI | InChI=1S/C14H13BrO4S/c1-17-11-7-10(15)12(18-2)6-9(11)8-19-14(16)13-4-3-5-20-13/h3-7H,8H2,1-2H3 |
| InChIKey | OPRUZBJMNHNLDJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |