C15H14BrNO4 — CID 9414456
(2-bromo-4,5-dimethoxyphenyl)methyl pyridine-3-carboxylate (PubChem CID 9414456) has the molecular formula C15H14BrNO4 and a molecular weight of 352.18 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)methyl pyridine-3-carboxylate.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 9414456 |
| Molecular Formula | C15H14BrNO4 |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)methyl pyridine-3-carboxylate |
| SMILES | COc1cc(Br)c(COC(=O)c2cccnc2)cc1OC |
| InChI | InChI=1S/C15H14BrNO4/c1-19-13-6-11(12(16)7-14(13)20-2)9-21-15(18)10-4-3-5-17-8-10/h3-8H,9H2,1-2H3 |
| InChIKey | FRXQRAIHJXOHBO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |