C16H17BrN2O3 — CID 100899430
N-[(1S)-1-(2-bromo-4,5-dimethoxyphenyl)ethyl]pyridine-3-carboxamide (PubChem CID 100899430) has the molecular formula C16H17BrN2O3 and a molecular weight of 365.23 g/mol. Its IUPAC name is N-[(1S)-1-(2-bromo-4,5-dimethoxyphenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | N-[(1S)-1-(2-bromo-4,5-dimethoxyphenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 100899430 |
| Molecular Formula | C16H17BrN2O3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | N-[(1S)-1-(2-bromo-4,5-dimethoxyphenyl)ethyl]pyridine-3-carboxamide |
| SMILES | COc1cc(Br)c([C@H](C)NC(=O)c2cccnc2)cc1OC |
| InChI | InChI=1S/C16H17BrN2O3/c1-10(19-16(20)11-5-4-6-18-9-11)12-7-14(21-2)15(22-3)8-13(12)17/h4-10H,1-3H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | OSQAMYRHMOFLKY-JTQLQIEISA-N |
| XLogP | 3.35 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |