C17H17Br2NO3 — CID 1220452
2-bromo-N-[(1R)-1-(2-bromo-4,5-dimethoxyphenyl)ethyl]benzamide (PubChem CID 1220452) has the molecular formula C17H17Br2NO3 and a molecular weight of 443.14 g/mol. Its IUPAC name is 2-bromo-N-[(1R)-1-(2-bromo-4,5-dimethoxyphenyl)ethyl]benzamide.
| Compound Name | 2-bromo-N-[(1R)-1-(2-bromo-4,5-dimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 1220452 |
| Molecular Formula | C17H17Br2NO3 |
| Molecular Weight | 443.14 g/mol |
| Exact Mass | 440.96 |
| IUPAC Name | 2-bromo-N-[(1R)-1-(2-bromo-4,5-dimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1cc(Br)c([C@@H](C)NC(=O)c2ccccc2Br)cc1OC |
| InChI | InChI=1S/C17H17Br2NO3/c1-10(20-17(21)11-6-4-5-7-13(11)18)12-8-15(22-2)16(23-3)9-14(12)19/h4-10H,1-3H3,(H,20,21)/t10-/m1/s1 |
| InChIKey | NUZDZSJKRIQNPX-SNVBAGLBSA-N |
| XLogP | 4.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.14 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |