C21H27NO5S — CID 51956574
N-[(1R)-1-(4,5-dimethoxy-2-methylphenyl)ethyl]-2-propylsulfonylbenzamide (PubChem CID 51956574) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[(1R)-1-(4,5-dimethoxy-2-methylphenyl)ethyl]-2-propylsulfonylbenzamide.
| Compound Name | N-[(1R)-1-(4,5-dimethoxy-2-methylphenyl)ethyl]-2-propylsulfonylbenzamide |
|---|---|
| PubChem CID | 51956574 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[(1R)-1-(4,5-dimethoxy-2-methylphenyl)ethyl]-2-propylsulfonylbenzamide |
| SMILES | CCCS(=O)(=O)c1ccccc1C(=O)N[C@H](C)c1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C21H27NO5S/c1-6-11-28(24,25)20-10-8-7-9-16(20)21(23)22-15(3)17-13-19(27-5)18(26-4)12-14(17)2/h7-10,12-13,15H,6,11H2,1-5H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | APJSITAFSDXQRN-OAHLLOKOSA-N |
| XLogP | 3.69 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |