C17H21NO4S — CID 94799638
N-[(1R)-1-(2,5-dimethylfuran-3-yl)ethyl]-2-ethylsulfonylbenzamide (PubChem CID 94799638) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-dimethylfuran-3-yl)ethyl]-2-ethylsulfonylbenzamide.
| Compound Name | N-[(1R)-1-(2,5-dimethylfuran-3-yl)ethyl]-2-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 94799638 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-[(1R)-1-(2,5-dimethylfuran-3-yl)ethyl]-2-ethylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)N[C@H](C)c1cc(C)oc1C |
| InChI | InChI=1S/C17H21NO4S/c1-5-23(20,21)16-9-7-6-8-14(16)17(19)18-12(3)15-10-11(2)22-13(15)4/h6-10,12H,5H2,1-4H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | UYVLXTWRZWCCIZ-GFCCVEGCSA-N |
| XLogP | 3.18 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |