C10H14BrNO2 — CID 63680874
2-bromo-N-[1-(2,5-dimethylfuran-3-yl)ethyl]acetamide (PubChem CID 63680874) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 2-bromo-N-[1-(2,5-dimethylfuran-3-yl)ethyl]acetamide.
| Compound Name | 2-bromo-N-[1-(2,5-dimethylfuran-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 63680874 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 2-bromo-N-[1-(2,5-dimethylfuran-3-yl)ethyl]acetamide |
| SMILES | Cc1cc(C(C)NC(=O)CBr)c(C)o1 |
| InChI | InChI=1S/C10H14BrNO2/c1-6-4-9(8(3)14-6)7(2)12-10(13)5-11/h4,7H,5H2,1-3H3,(H,12,13) |
| InChIKey | JTFOIBBGJCJRQG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|