C13H21NO3 — CID 63789405
tert-butyl N-[1-(2,5-dimethylfuran-3-yl)ethyl]carbamate (PubChem CID 63789405) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is tert-butyl N-[1-(2,5-dimethylfuran-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(2,5-dimethylfuran-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 63789405 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | tert-butyl N-[1-(2,5-dimethylfuran-3-yl)ethyl]carbamate |
| SMILES | Cc1cc(C(C)NC(=O)OC(C)(C)C)c(C)o1 |
| InChI | InChI=1S/C13H21NO3/c1-8-7-11(10(3)16-8)9(2)14-12(15)17-13(4,5)6/h7,9H,1-6H3,(H,14,15) |
| InChIKey | MXHWPAWZUPTOOH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |