C15H23NO4 — CID 63790271
tert-butyl N-[1-(2,5-dimethoxyphenyl)ethyl]carbamate (PubChem CID 63790271) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is tert-butyl N-[1-(2,5-dimethoxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(2,5-dimethoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 63790271 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | tert-butyl N-[1-(2,5-dimethoxyphenyl)ethyl]carbamate |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C15H23NO4/c1-10(16-14(17)20-15(2,3)4)12-9-11(18-5)7-8-13(12)19-6/h7-10H,1-6H3,(H,16,17) |
| InChIKey | AWHACUUHUYIHLN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |