C11H17NO2S — CID 107027131
N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2-sulfanylpropanamide (PubChem CID 107027131) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2-sulfanylpropanamide.
| Compound Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107027131 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2-sulfanylpropanamide |
| SMILES | Cc1cc(C(C)NC(=O)C(C)S)c(C)o1 |
| InChI | InChI=1S/C11H17NO2S/c1-6-5-10(8(3)14-6)7(2)12-11(13)9(4)15/h5,7,9,15H,1-4H3,(H,12,13) |
| InChIKey | WNRGROBAIIPCKA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|