C15H16INO2 — CID 47442999
N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2-iodobenzamide (PubChem CID 47442999) has the molecular formula C15H16INO2 and a molecular weight of 369.20 g/mol. Its IUPAC name is N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2-iodobenzamide.
| Compound Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 47442999 |
| Molecular Formula | C15H16INO2 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2-iodobenzamide |
| SMILES | Cc1cc(C(C)NC(=O)c2ccccc2I)c(C)o1 |
| InChI | InChI=1S/C15H16INO2/c1-9-8-13(11(3)19-9)10(2)17-15(18)12-6-4-5-7-14(12)16/h4-8,10H,1-3H3,(H,17,18) |
| InChIKey | APJZYITUJGXPCM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|