C15H15BrClNO2 — CID 103989173
3-bromo-2-chloro-N-[1-(2,5-dimethylfuran-3-yl)ethyl]benzamide (PubChem CID 103989173) has the molecular formula C15H15BrClNO2 and a molecular weight of 356.65 g/mol. Its IUPAC name is 3-bromo-2-chloro-N-[1-(2,5-dimethylfuran-3-yl)ethyl]benzamide.
| Compound Name | 3-bromo-2-chloro-N-[1-(2,5-dimethylfuran-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 103989173 |
| Molecular Formula | C15H15BrClNO2 |
| Molecular Weight | 356.65 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 3-bromo-2-chloro-N-[1-(2,5-dimethylfuran-3-yl)ethyl]benzamide |
| SMILES | Cc1cc(C(C)NC(=O)c2cccc(Br)c2Cl)c(C)o1 |
| InChI | InChI=1S/C15H15BrClNO2/c1-8-7-12(10(3)20-8)9(2)18-15(19)11-5-4-6-13(16)14(11)17/h4-7,9H,1-3H3,(H,18,19) |
| InChIKey | YOARSHFCICLHNU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |