C13H10BrCl2NOS — CID 113362339
3-bromo-2-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]benzamide (PubChem CID 113362339) has the molecular formula C13H10BrCl2NOS and a molecular weight of 379.11 g/mol. Its IUPAC name is 3-bromo-2-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]benzamide.
| Compound Name | 3-bromo-2-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 113362339 |
| Molecular Formula | C13H10BrCl2NOS |
| Molecular Weight | 379.11 g/mol |
| Exact Mass | 376.90 |
| IUPAC Name | 3-bromo-2-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1cccc(Br)c1Cl)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H10BrCl2NOS/c1-7(10-5-6-11(15)19-10)17-13(18)8-3-2-4-9(14)12(8)16/h2-7H,1H3,(H,17,18) |
| InChIKey | XBLQMFAOBUZWIP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.11 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |