C13H11Cl2NO2S — CID 106501533
2-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]-5-hydroxybenzamide (PubChem CID 106501533) has the molecular formula C13H11Cl2NO2S and a molecular weight of 316.21 g/mol. Its IUPAC name is 2-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]-5-hydroxybenzamide.
| Compound Name | 2-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]-5-hydroxybenzamide |
|---|---|
| PubChem CID | 106501533 |
| Molecular Formula | C13H11Cl2NO2S |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 2-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]-5-hydroxybenzamide |
| SMILES | CC(NC(=O)c1cc(O)ccc1Cl)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H11Cl2NO2S/c1-7(11-4-5-12(15)19-11)16-13(18)9-6-8(17)2-3-10(9)14/h2-7,17H,1H3,(H,16,18) |
| InChIKey | ZXOMMOWRKBXSHN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |