C12H11Cl2N3OS — CID 114922653
2-amino-5-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]pyridine-4-carboxamide (PubChem CID 114922653) has the molecular formula C12H11Cl2N3OS and a molecular weight of 316.21 g/mol. Its IUPAC name is 2-amino-5-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-amino-5-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114922653 |
| Molecular Formula | C12H11Cl2N3OS |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 2-amino-5-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]pyridine-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(N)ncc1Cl)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H11Cl2N3OS/c1-6(9-2-3-10(14)19-9)17-12(18)7-4-11(15)16-5-8(7)13/h2-6H,1H3,(H2,15,16)(H,17,18) |
| InChIKey | WAHDHPFZJDTRJG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |