C13H11ClFNOS — CID 47168597
N-[1-(5-chlorothiophen-2-yl)ethyl]-2-fluorobenzamide (PubChem CID 47168597) has the molecular formula C13H11ClFNOS and a molecular weight of 283.75 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-2-yl)ethyl]-2-fluorobenzamide.
| Compound Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 47168597 |
| Molecular Formula | C13H11ClFNOS |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-2-fluorobenzamide |
| SMILES | CC(NC(=O)c1ccccc1F)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H11ClFNOS/c1-8(11-6-7-12(14)18-11)16-13(17)9-4-2-3-5-10(9)15/h2-8H,1H3,(H,16,17) |
| InChIKey | SMCMIPJZLSYBNU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |