C12H11ClN2OS2 — CID 37316927
N-[(1R)-1-(5-chlorothiophen-2-yl)ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 37316927) has the molecular formula C12H11ClN2OS2 and a molecular weight of 298.82 g/mol. Its IUPAC name is N-[(1R)-1-(5-chlorothiophen-2-yl)ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[(1R)-1-(5-chlorothiophen-2-yl)ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 37316927 |
| Molecular Formula | C12H11ClN2OS2 |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | N-[(1R)-1-(5-chlorothiophen-2-yl)ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc[nH]c1=S)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H11ClN2OS2/c1-7(9-4-5-10(13)18-9)15-11(16)8-3-2-6-14-12(8)17/h2-7H,1H3,(H,14,17)(H,15,16)/t7-/m1/s1 |
| InChIKey | VKPSZJFWBMMZPU-SSDOTTSWSA-N |
| XLogP | 3.95 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|