C17H21ClN2O2S — CID 87040672
N-[1-(5-chlorothiophen-2-yl)ethyl]-2-[2-(dimethylamino)ethoxy]benzamide (PubChem CID 87040672) has the molecular formula C17H21ClN2O2S and a molecular weight of 352.89 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-2-yl)ethyl]-2-[2-(dimethylamino)ethoxy]benzamide.
| Compound Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-2-[2-(dimethylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 87040672 |
| Molecular Formula | C17H21ClN2O2S |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-2-[2-(dimethylamino)ethoxy]benzamide |
| SMILES | CC(NC(=O)c1ccccc1OCCN(C)C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H21ClN2O2S/c1-12(15-8-9-16(18)23-15)19-17(21)13-6-4-5-7-14(13)22-11-10-20(2)3/h4-9,12H,10-11H2,1-3H3,(H,19,21) |
| InChIKey | PGKNSVXRSGGCDO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |