C20H24BrNO4 — CID 1008434
N-[(1S)-1-(2-bromo-4,5-diethoxyphenyl)ethyl]-3-methoxybenzamide (PubChem CID 1008434) has the molecular formula C20H24BrNO4 and a molecular weight of 422.32 g/mol. Its IUPAC name is N-[(1S)-1-(2-bromo-4,5-diethoxyphenyl)ethyl]-3-methoxybenzamide.
| Compound Name | N-[(1S)-1-(2-bromo-4,5-diethoxyphenyl)ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 1008434 |
| Molecular Formula | C20H24BrNO4 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-[(1S)-1-(2-bromo-4,5-diethoxyphenyl)ethyl]-3-methoxybenzamide |
| SMILES | CCOc1cc(Br)c([C@H](C)NC(=O)c2cccc(OC)c2)cc1OCC |
| InChI | InChI=1S/C20H24BrNO4/c1-5-25-18-11-16(17(21)12-19(18)26-6-2)13(3)22-20(23)14-8-7-9-15(10-14)24-4/h7-13H,5-6H2,1-4H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | IPXGOPWZGKLOMJ-ZDUSSCGKSA-N |
| XLogP | 4.75 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |