C19H16BrNO4 — CID 8862362
(2-bromo-4,5-dimethoxyphenyl)methyl quinoline-2-carboxylate (PubChem CID 8862362) has the molecular formula C19H16BrNO4 and a molecular weight of 402.24 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)methyl quinoline-2-carboxylate.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)methyl quinoline-2-carboxylate |
|---|---|
| PubChem CID | 8862362 |
| Molecular Formula | C19H16BrNO4 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)methyl quinoline-2-carboxylate |
| SMILES | COc1cc(Br)c(COC(=O)c2ccc3ccccc3n2)cc1OC |
| InChI | InChI=1S/C19H16BrNO4/c1-23-17-9-13(14(20)10-18(17)24-2)11-25-19(22)16-8-7-12-5-3-4-6-15(12)21-16/h3-10H,11H2,1-2H3 |
| InChIKey | PEERRTLPJBTEGC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |