About (5-methyl-1,3,4-oxadiazol-2-yl)methyl quinoline-2-carboxylate
(5-methyl-1,3,4-oxadiazol-2-yl)methyl quinoline-2-carboxylate (PubChem CID 7812565) has the molecular formula C14H11N3O3
and a molecular weight of 269.26 g/mol. Its IUPAC name is (5-methyl-1,3,4-oxadiazol-2-yl)methyl quinoline-2-carboxylate.
Analyze (5-methyl-1,3,4-oxadiazol-2-yl)methyl quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,3,4-oxadiazol-2-yl)methyl quinoline-2-carboxylate?
The IUPAC name of (5-methyl-1,3,4-oxadiazol-2-yl)methyl quinoline-2-carboxylate (CID 7812565) is (5-methyl-1,3,4-oxadiazol-2-yl)methyl quinoline-2-carboxylate.
What is the SMILES notation for (5-methyl-1,3,4-oxadiazol-2-yl)methyl quinoline-2-carboxylate?
The canonical SMILES for (5-methyl-1,3,4-oxadiazol-2-yl)methyl quinoline-2-carboxylate is Cc1nnc(COC(=O)c2ccc3ccccc3n2)o1.
What is the InChIKey of (5-methyl-1,3,4-oxadiazol-2-yl)methyl quinoline-2-carboxylate?
The InChIKey is YMUXAKVVZJVTHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O3/c1-9-16-17-13(20-9)8-19-14(18)12-7-6-10-4-2-3-5-11(10)15-12/h2-7H,8H2,1H3.
What are the key properties of (5-methyl-1,3,4-oxadiazol-2-yl)methyl quinoline-2-carboxylate?
(5-methyl-1,3,4-oxadiazol-2-yl)methyl quinoline-2-carboxylate has a molecular weight of 269.26 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,3,4-oxadiazol-2-yl)methyl quinoline-2-carboxylate is sourced from PubChem (CID 7812565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).