C28H22N4O4 — CID 91594053
N-[4,5-dimethoxy-2-(quinoline-2-carbonylamino)phenyl]quinoline-2-carboxamide (PubChem CID 91594053) has the molecular formula C28H22N4O4 and a molecular weight of 478.51 g/mol. Its IUPAC name is N-[4,5-dimethoxy-2-(quinoline-2-carbonylamino)phenyl]quinoline-2-carboxamide.
| Compound Name | N-[4,5-dimethoxy-2-(quinoline-2-carbonylamino)phenyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 91594053 |
| Molecular Formula | C28H22N4O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-[4,5-dimethoxy-2-(quinoline-2-carbonylamino)phenyl]quinoline-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc3ccccc3n2)c(NC(=O)c2ccc3ccccc3n2)cc1OC |
| InChI | InChI=1S/C28H22N4O4/c1-35-25-15-23(31-27(33)21-13-11-17-7-3-5-9-19(17)29-21)24(16-26(25)36-2)32-28(34)22-14-12-18-8-4-6-10-20(18)30-22/h3-16H,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | AVLZUIMUJMJQNH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |