C24H18N4O2 — CID 122323135
N-(5-imidazo[1,2-a]pyridin-2-yl-2-methoxyphenyl)quinoline-2-carboxamide (PubChem CID 122323135) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-(5-imidazo[1,2-a]pyridin-2-yl-2-methoxyphenyl)quinoline-2-carboxamide.
| Compound Name | N-(5-imidazo[1,2-a]pyridin-2-yl-2-methoxyphenyl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 122323135 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-(5-imidazo[1,2-a]pyridin-2-yl-2-methoxyphenyl)quinoline-2-carboxamide |
| SMILES | COc1ccc(-c2cn3ccccc3n2)cc1NC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C24H18N4O2/c1-30-22-12-10-17(21-15-28-13-5-4-8-23(28)26-21)14-20(22)27-24(29)19-11-9-16-6-2-3-7-18(16)25-19/h2-15H,1H3,(H,27,29) |
| InChIKey | NWOXGHQCPIMDDC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |