C21H16BrN3O2 — CID 122323285
3-bromo-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methoxyphenyl)benzamide (PubChem CID 122323285) has the molecular formula C21H16BrN3O2 and a molecular weight of 422.28 g/mol. Its IUPAC name is 3-bromo-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methoxyphenyl)benzamide.
| Compound Name | 3-bromo-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 122323285 |
| Molecular Formula | C21H16BrN3O2 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 3-bromo-N-(5-imidazo[1,2-a]pyridin-2-yl-2-methoxyphenyl)benzamide |
| SMILES | COc1ccc(-c2cn3ccccc3n2)cc1NC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C21H16BrN3O2/c1-27-19-9-8-14(18-13-25-10-3-2-7-20(25)23-18)12-17(19)24-21(26)15-5-4-6-16(22)11-15/h2-13H,1H3,(H,24,26) |
| InChIKey | JTHYJIBEHNEOKL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |