About [2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate
[2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate (PubChem CID 805957) has the molecular formula C19H15NO4
and a molecular weight of 321.33 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate.
Molecular Properties
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate |
| PubChem CID | 805957 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C19H15NO4/c1-23-15-9-6-14(7-10-15)18(21)12-24-19(22)17-11-8-13-4-2-3-5-16(13)20-17/h2-11H,12H2,1H3 |
| InChIKey | BSYQOWOVDFTFFO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate?
The IUPAC name of [2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate (CID 805957) is [2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate.
What is the SMILES notation for [2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate?
The canonical SMILES for [2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate is COc1ccc(C(=O)COC(=O)c2ccc3ccccc3n2)cc1.
What is the InChIKey of [2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate?
The InChIKey is BSYQOWOVDFTFFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO4/c1-23-15-9-6-14(7-10-15)18(21)12-24-19(22)17-11-8-13-4-2-3-5-16(13)20-17/h2-11H,12H2,1H3.
What are the key properties of [2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate?
[2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate has a molecular weight of 321.33 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methoxyphenyl)-2-oxoethyl] quinoline-2-carboxylate is sourced from PubChem (CID 805957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).