C21H16N2O3S — CID 7813125
[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl quinoline-2-carboxylate (PubChem CID 7813125) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl quinoline-2-carboxylate.
| Compound Name | [2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl quinoline-2-carboxylate |
|---|---|
| PubChem CID | 7813125 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | [2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl quinoline-2-carboxylate |
| SMILES | COc1ccc(-c2nc(COC(=O)c3ccc4ccccc4n3)cs2)cc1 |
| InChI | InChI=1S/C21H16N2O3S/c1-25-17-9-6-15(7-10-17)20-22-16(13-27-20)12-26-21(24)19-11-8-14-4-2-3-5-18(14)23-19/h2-11,13H,12H2,1H3 |
| InChIKey | HTERLJJAZAAEGR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |