C17H17BrO4 — CID 7663223
(4,5-dimethoxy-2-methylphenyl)methyl 3-bromobenzoate (PubChem CID 7663223) has the molecular formula C17H17BrO4 and a molecular weight of 365.22 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)methyl 3-bromobenzoate.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)methyl 3-bromobenzoate |
|---|---|
| PubChem CID | 7663223 |
| Molecular Formula | C17H17BrO4 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)methyl 3-bromobenzoate |
| SMILES | COc1cc(C)c(COC(=O)c2cccc(Br)c2)cc1OC |
| InChI | InChI=1S/C17H17BrO4/c1-11-7-15(20-2)16(21-3)9-13(11)10-22-17(19)12-5-4-6-14(18)8-12/h4-9H,10H2,1-3H3 |
| InChIKey | OQNZXWUFJHNNEK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |