C25H24O5 — CID 7718092
(4,5-dimethoxy-2-methylphenyl)methyl 2-(4-methylbenzoyl)benzoate (PubChem CID 7718092) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)methyl 2-(4-methylbenzoyl)benzoate.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)methyl 2-(4-methylbenzoyl)benzoate |
|---|---|
| PubChem CID | 7718092 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)methyl 2-(4-methylbenzoyl)benzoate |
| SMILES | COc1cc(C)c(COC(=O)c2ccccc2C(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C25H24O5/c1-16-9-11-18(12-10-16)24(26)20-7-5-6-8-21(20)25(27)30-15-19-14-23(29-4)22(28-3)13-17(19)2/h5-14H,15H2,1-4H3 |
| InChIKey | TYZWTKDYVIQZPL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |