C17H16ClFO4 — CID 8620660
(4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate (PubChem CID 8620660) has the molecular formula C17H16ClFO4 and a molecular weight of 338.76 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8620660 |
| Molecular Formula | C17H16ClFO4 |
| Molecular Weight | 338.76 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate |
| SMILES | COc1cc(C)c(COC(=O)c2cc(Cl)ccc2F)cc1OC |
| InChI | InChI=1S/C17H16ClFO4/c1-10-6-15(21-2)16(22-3)7-11(10)9-23-17(20)13-8-12(18)4-5-14(13)19/h4-8H,9H2,1-3H3 |
| InChIKey | XOBPWNUFMGFHPG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.76 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |