(4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate

C17H16ClFO4 — CID 8620660

IUPAC(4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate
SMILESCOc1cc(C)c(COC(=O)c2cc(Cl)ccc2F)cc1OC
InChIInChI=1S/C17H16ClFO4/c1-10-6-15(21-2)16(22-3)7-11(10)9-23-17(20)13-8-12(18)4-5-14(13)19/h4-8H,9H2,1-3H3
InChIKeyXOBPWNUFMGFHPG-UHFFFAOYSA-N
MW338.76 g/mol
LogP4.16
Rot. Bonds5

About (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate

(4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate (PubChem CID 8620660) has the molecular formula C17H16ClFO4 and a molecular weight of 338.76 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate.

Molecular Properties

Compound Name(4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate
PubChem CID8620660
Molecular FormulaC17H16ClFO4
Molecular Weight338.76 g/mol
Exact Mass338.07
IUPAC Name(4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate
SMILESCOc1cc(C)c(COC(=O)c2cc(Cl)ccc2F)cc1OC
InChIInChI=1S/C17H16ClFO4/c1-10-6-15(21-2)16(22-3)7-11(10)9-23-17(20)13-8-12(18)4-5-14(13)19/h4-8H,9H2,1-3H3
InChIKeyXOBPWNUFMGFHPG-UHFFFAOYSA-N
XLogP4.16
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500338.76
LogP ≤ 54.16
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate?
The IUPAC name of (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate (CID 8620660) is (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate.
What is the SMILES notation for (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate?
The canonical SMILES for (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate is COc1cc(C)c(COC(=O)c2cc(Cl)ccc2F)cc1OC.
What is the InChIKey of (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate?
The InChIKey is XOBPWNUFMGFHPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClFO4/c1-10-6-15(21-2)16(22-3)7-11(10)9-23-17(20)13-8-12(18)4-5-14(13)19/h4-8H,9H2,1-3H3.
What are the key properties of (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate?
(4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate has a molecular weight of 338.76 g/mol, XLogP of 4.16, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dimethoxy-2-methylphenyl)methyl 5-chloro-2-fluorobenzoate is sourced from PubChem (CID 8620660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).