C17H18FNO5S — CID 18125525
(2-methoxy-5-methylphenyl)methyl 2-fluoro-5-(methylsulfamoyl)benzoate (PubChem CID 18125525) has the molecular formula C17H18FNO5S and a molecular weight of 367.40 g/mol. Its IUPAC name is (2-methoxy-5-methylphenyl)methyl 2-fluoro-5-(methylsulfamoyl)benzoate.
| Compound Name | (2-methoxy-5-methylphenyl)methyl 2-fluoro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 18125525 |
| Molecular Formula | C17H18FNO5S |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | (2-methoxy-5-methylphenyl)methyl 2-fluoro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)OCc2cc(C)ccc2OC)c1 |
| InChI | InChI=1S/C17H18FNO5S/c1-11-4-7-16(23-3)12(8-11)10-24-17(20)14-9-13(5-6-15(14)18)25(21,22)19-2/h4-9,19H,10H2,1-3H3 |
| InChIKey | FHIUPQJCGDYADA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |