C16H16FNO5S — CID 9320186
(5-fluoro-2-methoxyphenyl)methyl 3-(methylsulfamoyl)benzoate (PubChem CID 9320186) has the molecular formula C16H16FNO5S and a molecular weight of 353.37 g/mol. Its IUPAC name is (5-fluoro-2-methoxyphenyl)methyl 3-(methylsulfamoyl)benzoate.
| Compound Name | (5-fluoro-2-methoxyphenyl)methyl 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 9320186 |
| Molecular Formula | C16H16FNO5S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | (5-fluoro-2-methoxyphenyl)methyl 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)OCc2cc(F)ccc2OC)c1 |
| InChI | InChI=1S/C16H16FNO5S/c1-18-24(20,21)14-5-3-4-11(9-14)16(19)23-10-12-8-13(17)6-7-15(12)22-2/h3-9,18H,10H2,1-2H3 |
| InChIKey | SGBLCPHTDSYNSR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |