C23H20FNO6S — CID 35808878
(5-acetyl-2-methoxyphenyl)methyl 3-[(4-fluorophenyl)sulfamoyl]benzoate (PubChem CID 35808878) has the molecular formula C23H20FNO6S and a molecular weight of 457.48 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl 3-[(4-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl 3-[(4-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 35808878 |
| Molecular Formula | C23H20FNO6S |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl 3-[(4-fluorophenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(C(C)=O)cc1COC(=O)c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H20FNO6S/c1-15(26)16-6-11-22(30-2)18(12-16)14-31-23(27)17-4-3-5-21(13-17)32(28,29)25-20-9-7-19(24)8-10-20/h3-13,25H,14H2,1-2H3 |
| InChIKey | NLBQYPDGDGNZPT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |