C14H14N2O5S2 — CID 26951365
3-acetyl-N-(4-sulfamoylphenyl)benzenesulfonamide (PubChem CID 26951365) has the molecular formula C14H14N2O5S2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-acetyl-N-(4-sulfamoylphenyl)benzenesulfonamide.
| Compound Name | 3-acetyl-N-(4-sulfamoylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 26951365 |
| Molecular Formula | C14H14N2O5S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 3-acetyl-N-(4-sulfamoylphenyl)benzenesulfonamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)Nc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C14H14N2O5S2/c1-10(17)11-3-2-4-14(9-11)23(20,21)16-12-5-7-13(8-6-12)22(15,18)19/h2-9,16H,1H3,(H2,15,18,19) |
| InChIKey | DSHIRPGAHXPEEV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |