C15H14N2O6S2 — CID 3530027
3-[3-[(4-sulfamoylphenyl)sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 3530027) has the molecular formula C15H14N2O6S2 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-[3-[(4-sulfamoylphenyl)sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[(4-sulfamoylphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 3530027 |
| Molecular Formula | C15H14N2O6S2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 3-[3-[(4-sulfamoylphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)c2cccc(C=CC(=O)O)c2)cc1 |
| InChI | InChI=1S/C15H14N2O6S2/c16-24(20,21)13-7-5-12(6-8-13)17-25(22,23)14-3-1-2-11(10-14)4-9-15(18)19/h1-10,17H,(H,18,19)(H2,16,20,21) |
| InChIKey | RFPRWDPPMAVNSO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|